|
 |
Product name: |
Benzoyl chloride |
Alias: |
Benzoyl chloride 99.5+ % for analysis; Benzoil chloride; 4-Chlorocarbonylpolystyrene; alpha-chloro-benzaldehyd; O-Chloroformylbenzene |
CAS RN: |
98-88-4 |
EINECS No.: |
202-710-8 |
Molecular formula: |
C7H5ClO |
Molecular weight: |
140.56 |
InChI: |
InChI=1/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
Molecular structure: |
 |
Density: |
1.2188 |
Melting point: |
-1℃ |
Boiling point: |
198℃ |
Flash point: |
68℃ |
Solubility: |
reacts |
| Physicochemical properties: |
Property Colorless transparent and flammable liquid, fuming if exposed in the air. It has irritating odor Solubility Soluble in ether, trichloromethane, benzene and carbon disulfide. Decompose and produce benzoic acid, benzamide, ethyl benzoate and hydrogen chloride contact with water, ammonia or ethyl alcohol |
| Usage: |
Used as dye intermediate, initiator, UV absorber, rubber auxiliary, pharmaceutical, etc. |
| < Order > < Back > |
|
|
