|
 |
Product name: |
1,3,5-Trichlorobenzene |
Alias: |
sym-Trichlorobenzene |
CAS RN: |
108-70-3 |
EINECS No.: |
203-608-6 |
Molecular formula: |
C6H3Cl3 |
Molecular weight: |
181.447 |
InChI: |
InChI=1/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H |
Molecular structure: |
 |
Density: |
1.448g/cm3 |
Melting point: |
63-65℃ |
Boiling point: |
211.3°C at 760 mmHg |
Flash point: |
126.7°C |
Vapor pressure: |
0.267mmHg at 25°C |
| Physicochemical properties: |
Property Acicular crystal.
Melting point 63.5℃
Boiling point 208.5℃
Solubility Insoluble in water, slightly soluble in ethyl alcohol, easily soluble in ethyl ether. |
| Usage: |
Uses as solvent in the production of pesticide, dye, medicine, electrolyte, lubricant, etc. |
| < Order > < Back > |
|
|