|
 |
Product name: |
4'-Hydroxyacetophenone |
CAS No.: |
99-93-4 |
EINECS No.: |
202-802-8 |
Molecular formula: |
C8H8O2 |
Molecular weight: |
136.1479 |
InChI: |
InChI=1/C8H8O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H3 |
Structural formula: |
 |
Density: |
1.14g/cm3 |
Melting point: |
107-111℃ |
Boiling point: |
313°C at 760 mmHg |
Flash point: |
121.2°C |
Water solubility: |
10 g/L (22℃) |
Vapor Pressure: |
0.000278mmHg at 25°C |
Appearance: |
off-white crystalline powder |
Physical and Chemical Properties: |
Appearance white crystal
Solubility Easily soluble in hot water, methanol, ether and acetone; insoluble in petroleum ether |
Uses: |
Used in the manufacture of cholagogue and as the raw material of other organic synthesis |
|
|
|