|
 |
| Product name: |
3-Chloroaniline |
| Alias: |
3-Chlorobenzenamine; fast orange GC base; m-Chloroaniline; 3-chlorobenzeneamine; m-chloro aniline; 3-chloroaniline hydrochloride (1:1); 3-Halide |
| CAS No.: |
108-42-9 |
| EINECS No.: |
203-581-0 |
| Molecular formula: |
C6H6ClN |
| Molecular weight: |
127.57334 |
| InChI: |
InChI=1/C6H6ClN.ClH/c7-5-2-1-3-6(8)4-5;/h1-4H,8H2;1H |
| Structural formula: |
 |
| Melting point: |
-11℃ |
| Boiling point: |
227.8°C at 760 mmHg |
| Flash point: |
123.9°C |
| Water solubility: |
6.8 g/L (20℃) |
| Vapor Pressure: |
0.0762mmHg at 25°C |
Physical and
Chemical Properties: |
Appearance: Colorless liquid to light amber liquid
Melting point
(℃): -10
Boiling point(℃): 230.5
Relative Density(water=1): 1.22
Saturated Vapor pressure (kPa): 0.13(63.5℃)
Critical pressure(MPa): NA
Distribution coefficient of octanol/water
: 1.88
Flash point(℃): 123.9
Refractive index
[1]: n20/D 1.594(lit.)
Solubility: Insoluble in water, soluble in most organic solvents. |
| Uses: |
Used in organic synthesis, as intermediate of azo dye and pigment, medicine, insecticide, pesticide chemicals. |
|
|
|
