| |
|
| |
| Tel：+86-513-84365999 |
| Fax：+86-513-84319899 |
| E-mail：sales@jinruiint.com |
| Address:No.80,Jiaotong Road, Chahe Town,Rudong County, Jiangsu Province, China |
| P.C.226403 |
|
|
 |
Product: Methyl acetoacetate
English name: Methyl acetoacetate
CAS NO: 105-45-3
Molecular weight: 116.1152
EC NO: 203-299-8
Molecular formula: C5H8O3
InChI: InChI=1/C5H8O3/c1-4(6)3-5(7)8-2/h3H2,1-2H3
Spec.: Liquid
Packing: Plastic drum, net weight 220kg, or packed according to the customers' requirement.
Product description: Physicochemical property Property Colorless transparent liquid with aromatic odor. Melting point -80℃ Boiling point 171.7℃ Relative density 1.0762 Refractive index 1.4184 Flash point 70℃ Solubility Soluble in ethyl alcohol and ethyl ether, slightly soluble in water. Use: The product is the component of cellulose ether mixed solvent, it can be used in pesticide, pharmaceutical, dye, pigment, molecular stabilizer and other organic synthesis.
Alias: Methyl acetoacetaten; Acetoacetic acid methyl ester; Butanoic acid, 3-oxo-, methyl ester:; methyl 3-oxobutanoate; MAA
Structural formula: 
Picture:  |
|
|
|
